AMB3489010

back to the search
Structure Amb3489010
InchiKey BBMMLAFHBKDVAL-UHFFFAOYSA-N
Smiles Cc1ccc(cc1)C1=NNC2(S1)C(=O)Nc1c2cccc1
names
  • 5'-(4-methylphenyl)spiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one
Molecular weight 295.359
formula C16H13N3OS
num atoms 34
num bonds 37
num rotors 1
num rings 4
logP 2.7005
PSA 78.79
MR 95.0824