AMB11036278

back to the search
Structure Amb11036278
InchiKey DUVLYWRLPNUXKZ-UHFFFAOYSA-N
Smiles O=C(NC(c1cc(Cl)c2c(c1O)nccc2)c1ccc(cc1)Cl)COc1ccccc1
names
  • N-[(5-chloro-8-hydroxy-7-quinolinyl)(4-chlorophenyl)methyl]-2-phenoxyacetamide
Molecular weight 453.317
formula C24H18Cl2N2O3
num atoms 49
num bonds 52
num rotors 7
num rings 4
logP 5.9227
PSA 71.45
MR 121.868