AMB11036272

back to the search
Structure Amb11036272
InchiKey BPJFUFKLLCAQMG-UHFFFAOYSA-N
Smiles COc1ccc(cc1)C(c1cc(Cl)c2c(c1O)nccc2)NC(=O)COc1ccccc1
names
  • N-[(5-chloro-8-hydroxy-7-quinolinyl)(4-methoxyphenyl)methyl]-2-phenoxyacetamide
Molecular weight 448.898
formula C25H21ClN2O4
num atoms 53
num bonds 56
num rotors 8
num rings 4
logP 5.2779
PSA 80.68
MR 123.35