AMB2713896

back to the search
Structure Amb2713896
InchiKey LJSSOYOUTKPEIR-UHFFFAOYSA-N
Smiles Cc1ccc(cc1)C1=NNC2(S1)c1ccccc1N(C2=O)C
Molecular weight 309.385
formula C17H15N3OS
num atoms 37
num bonds 40
num rotors 1
num rings 4
logP 2.6518
PSA 70
MR 99.9837