AMB20624167

back to the search
Structure Amb20624167
InchiKey LUADWBRFKJIIAV-UHFFFAOYSA-N
Smiles Cc1cc(NCC2CCCO2)[n]c2ccccc21
Molecular weight 242.316
formula C15H18N2O
num atoms 36
num bonds 38
num rotors 3
num rings 3
logP 3.2071
PSA 34.15
MR 74.2137